| Identification | |
| Name: | 1H-Indene, 2-methyl- |
| Synonyms: | Indene,2-methyl- (7CI,8CI); 2-Methyl-1H-indene; 2-Methylindene |
| CAS: | 2177-47-1 |
| Molecular Formula: | C10H10 |
| Molecular Weight: | 130.1864 |
| InChI: | InChI=1/C10H10/c1-8-6-9-4-2-3-5-10(9)7-8/h2-6H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 3 |
| Flash Point: | 76 ºC |
| Density: | 0.971 |
| Stability: | No data. |
| Refractive index: | 1.567 |
| Solubility: | Insoluble |
| Appearance: | Colorless to Yellow Liquid |
| Specification: |
2-Methylindene (CAS No.2177-47-1), its synonyms are 1H-indene, 2-methyl- ; 2-Methyl-1H-indene . |
| Packinggroup: | II; III |
| Flash Point: | 76 ºC |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
 |
|
