Identification |
Name: | Pentanoic acid,3-methyl-, methyl ester |
Synonyms: | Valericacid, 3-methyl-, methyl ester (6CI,7CI,8CI); 3-Methylpentanoic acid methylester; 3-Methylvaleric acid methyl ester; Methyl 3-methylpentanoate; Methyl b-methylvalerate |
CAS: | 2177-78-8 |
Molecular Formula: | C7H14 O2 |
Molecular Weight: | 130.18 |
InChI: | InChI=1/C7H14O2/c1-4-6(2)5-7(8)9-3/h6H,4-5H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3272 3/PG 3 |
Flash Point: | 41 °C |
Boiling Point: | 135.1°C at 760 mmHg |
Density: | 0.88 g/mL at 20 °C(lit.) |
Refractive index: | n20/D 1.405 |
Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
Packinggroup: | III |
Flash Point: | 41 °C |
Safety Data |
|
 |