| Identification | |
| Name: | Pentanoic acid,3-methyl-, methyl ester |
| Synonyms: | Valericacid, 3-methyl-, methyl ester (6CI,7CI,8CI); 3-Methylpentanoic acid methylester; 3-Methylvaleric acid methyl ester; Methyl 3-methylpentanoate; Methyl b-methylvalerate |
| CAS: | 2177-78-8 |
| Molecular Formula: | C7H14 O2 |
| Molecular Weight: | 130.18 |
| InChI: | InChI=1/C7H14O2/c1-4-6(2)5-7(8)9-3/h6H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 3/PG 3 |
| Flash Point: | 41 °C |
| Boiling Point: | 135.1°C at 760 mmHg |
| Density: | 0.88 g/mL at 20 °C(lit.) |
| Refractive index: | n20/D 1.405 |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| Flash Point: | 41 °C |
| Safety Data | |
 |
|
