| Identification | |
| Name: | Prop-1-ene-1,3-sultone |
| Synonyms: | 5H-1,2-Oxathiole 2,2-dioxide |
| CAS: | 21806-61-1 |
| Molecular Formula: | C3H4O3S |
| Molecular Weight: | 120.13 |
| InChI: | InChI=1/C3H4O3S/c4-7(5)3-1-2-6-7/h1,3H,2H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.508 |
| Refractive index: | 1.523 |
| Specification: |
The Prop-1-ene-1,3-sultone with the CAS number 21806-61-1 is also called 1,3-Propene sultone. The systematic name is 5H-1,2-oxathiole 2,2-dioxide. Its molecular formula is C3H4O3S. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the Prop-1-ene-1,3-sultone are: (1)ACD/LogP: -0.79; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.79; (4)ACD/LogD (pH 7.4): -0.79; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 8.89; (8)ACD/KOC (pH 7.4): 8.89; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 51.75 Å2; (13)Index of Refraction: 1.523; (14)Molar Refractivity: 24.35 cm3; (15)Molar Volume: 79.6 cm3; (16)Polarizability: 9.65×10-24cm3; (17)Surface Tension: 47.2 dyne/cm; (18)Enthalpy of Vaporization: 47.41 kJ/mol; (19)Vapour Pressure: 0.0245 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
