| Identification | |
| Name: | Benzene,5-bromo-1,2,3-trichloro- |
| Synonyms: | 5-Bromo-1,2,3-trichlorobenzene;Bromo-3,4,5-trichlorobenzene; |
| CAS: | 21928-51-8 |
| Molecular Formula: | C6H2BrCl3 |
| Molecular Weight: | 260.34 |
| InChI: | InChI=1/C6H2BrCl3/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.84 |
| Refractive index: | 1.603 |
| Specification: |
The 3,4,5-Trichlorobromobenzene is a chemical with the fomular C6H2BrCl3. The systematic name of this product is 5-bromo-1,2,3-trichlorobenzene . With the CAS registry number 21928-51-8, it is also named as 5-Bromo-1,2,3-trichlorobenzene ; Benzene, 5-bromo-1,2,3-trichloro- . The product can be used as pharmaceutical intermediate. The other characteristics of this product can be summarized as: (1)ACD/BCF (pH 5.5): 1246.06 ; (2)ACD/BCF (pH 7.4): 1246.06 ; (3)ACD/KOC (pH 5.5): 5719.86 ; (4)ACD/KOC (pH 7.4): 5719.86 ; (5)Index of Refraction: 1.603 ; (6)Molar Refractivity: 48.62 cm3 ; (7)Molar Volume: 141.4 cm3 ; (8)Polarizability: 19.27×10-24 cm3 ; (9)Surface Tension: 44.4 dyne/cm ; (10)Enthalpy of Vaporization: 48.35 kJ/mol ; (11)Vapour Pressure: 0.0147 mmHg at 25°C. People can use the following data to convert to the molecule structure. 1. SMILES: Clc1c(Cl)cc(Br)cc1Cl; 2. InChI: InChI=1/C6H2BrCl3/c7-3-1-4(8)6(10)5(9)2-3/h1-2H; 3. InChIKey: VZUMVBQMJFFYRM-UHFFFAOYAH. 3,4,5-Trichlorobromobenzene has many suppliers, such as Beijing Eternalchem Co., Ltd. and Shanghai Rainbow Chemistry Co., Ltd.. |
| Safety Data | |
 |
|
