| Identification | |
| Name: | 6-Quinolinecarboxylicacid, 4-bromo- |
| Synonyms: | 4-bromoquinoline-6-carboxylic acid |
| CAS: | 219763-87-8 |
| Molecular Formula: | C10H6 Br N O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H6BrNO2/c11-8-3-4-12-9-2-1-6(10(13)14)5-7(8)9/h1-5H,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.733 g/cm3 |
| Refractive index: | 1.709 |
| Specification: |
The cas register number of Ethyl imidazole-2-carboxylate is 219763-87-8. It also can be called as 4-bromoquinoline-6-carboxylic acid and the Systematic name about this chemical is 4-Bromoquinoline-6-carboxylic acid. Physical properties about Ethyl imidazole-2-carboxylater are: (1)ACD/LogP: 3.07; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 8; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 50.19Å2; (12)Index of Refraction: 1.709; (13)Molar Refractivity: 56.807 cm3; (14)Molar Volume: 145.487 cm3; (15)Surface Tension: 68.061 dyne/cm; (16)Density: 1.733 g/cm3; (17)Flash Point: 197.567 °C; (18)Enthalpy of Vaporization: 68.998 kJ/mol; (19)Boiling Point: 403.065 °C at 760 mmHg; (20)Vapour Pressure: 0 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
