Identification |
Name: | Benzenamine,2,3,4,5,6-pentanitro- |
Synonyms: | Aniline,2,3,4,5,6-pentanitro- (7CI,8CI); 2,3,4,5,6-Pentanitroaniline; Pentanitroaniline |
CAS: | 21985-87-5 |
Molecular Formula: | C6H2 N6 O10 |
Molecular Weight: | 318.12 |
InChI: | InChI=1/C6H2N6O10/c7-1-2(8(13)14)4(10(17)18)6(12(21)22)5(11(19)20)3(1)9(15)16/h7H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 358.9°C |
Boiling Point: | 669.8°C at 760 mmHg |
Density: | 2.107g/cm3 |
Refractive index: | 1.778 |
Specification: |
Pentanitroaniline (CAS NO.21985-87-5) can be reacted with ammonia in benzene, dichloromethane or another similar solvent to produce triaminotrinitrobenzene (TATB), an insensitive high explosive, used in nuclear bombs and other critical applications.
Pentanitroaniline (CAS NO.21985-87-5) is regulated by the United States Department of Transportation (DoT) as a "forbidden explosive" that is too dangerous to transport over public thoroughfares or by air.
|
Flash Point: | 358.9°C |
Safety Data |
|
 |