| Identification | |
| Name: | 1H-Pyrrole-2-carboxylicacid, ethyl ester |
| Synonyms: | Pyrrole-2-carboxylicacid, ethyl ester (6CI,7CI,8CI);2-Ethoxycarbonylpyrrole;Ethyl1H-pyrrole-2-carboxylate;Ethyl 2-pyrrolecarboxylate;NSC 81360; |
| CAS: | 2199-43-1 |
| Molecular Formula: | C7H9NO2 |
| Molecular Weight: | 139.15 |
| InChI: | InChI=1/C7H9NO2/c1-2-10-7(9)6-4-3-5-8-6/h3-5,8H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 37-39°C |
| Flash Point: | 101.7°C |
| Boiling Point: | 70°C 0,8mm |
| Density: | 1.139g/cm3 |
| Refractive index: | 1.519 |
| Specification: |
Ethyl pyrrole-2-carboxylate (CAS NO.2199-43-1), its Synonyms are Pyrrole-2-carboxylic acid ethyl ester ; Ethyl 1H-pyrrole-2-carboxylate . |
| Flash Point: | 101.7°C |
| Storage Temperature: | Room temperature. |
| Usage: | A pyrole derivative used in the preparation of heterocyclic bioactive agents and other pharmaceutical compounds. A catalyst in olefin polymerization. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
