| Identification |
| Name: | L-Cysteine,N-acetyl-S-(2,3,4-trihydroxybutyl)- |
| Synonyms: | N-Acetyl-S-(2,3,4-trihydroxybutyl)-L-cysteine;S-(2,3,4-Trihydroxybutyl)mercapturic Acid |
| CAS: | 219965-90-9 |
| Molecular Formula: | C9H17 N O6 S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H17NO6S/c1-5(12)10-6(9(15)16)3-17-4-8(14)7(13)2-11/h6-8,11,13-14H,2-4H2,1H3,(H,10,12)(H,15,16)/t6-,7?,8?/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 371.055°C |
| Boiling Point: | 689.927°C at 760 mmHg |
| Density: | 1.443g/cm3 |
| Refractive index: | 1.577 |
| Flash Point: | 371.055°C |
| Usage: | A metabolite of butadiene and butadiene monoepoxide; relevance to cancer susceptibility. |
| Safety Data |
| |
 |
