| Identification | |
| Name: | Benzene,5-(bromomethyl)-1,2,3-trifluoro- |
| Synonyms: | 3,4,5-Trifluorobenzylbromide; 5-(Bromomethyl)-1,2,3-trifluorobenzene |
| CAS: | 220141-72-0 |
| Molecular Formula: | C7H4 Br F3 |
| Molecular Weight: | 225.00 |
| InChI: | InChI=1/C7H4BrF3/c8-3-4-1-5(9)7(11)6(10)2-4/h1-2H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 8/PG 3 |
| Flash Point: | 75.1°C |
| Boiling Point: | 188.4°Cat760mmHg |
| Density: | 1.689 |
| Refractive index: | n20/D 1.5050(lit.) |
| Specification: |
Removal in wastewater treatment of 3,4,5-Trifluorobenzyl bromide (220141-72-0) can be stated as follows: |
| Packinggroup: | II |
| Flash Point: | 75.1°C |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
