| Identification | |
| Name: | 2-Pentanone, 5-nitro- |
| Synonyms: | 1-Acetyl-3-nitropropane;1-Nitro-4-pentanone;5-Nitro-2-pentanone; |
| CAS: | 22020-87-7 |
| Molecular Formula: | C5H9NO3 |
| Molecular Weight: | 131.13 |
| InChI: | InChI=1/C5H9NO3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.084 g/cm3 |
| Refractive index: | 1.43 |
| Specification: |
The 5-Nitro-2-pentanone with the CAS number 22020-87-7 is also called 2-Pentanone, 5-nitro-. The systematic name is 5-nitropentan-2-one. Its molecular formula is C5H9NO3. The product category is Acetylgroup. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 5-Nitro-2-pentanone are: (1)ACD/LogP: 0.15; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 62.89 Å2; (7)Index of Refraction: 1.43; (8)Molar Refractivity: 31.26 cm3; (9)Molar Volume: 120.9 cm3; (10)Polarizability: 12.39×10-24cm3; (11)Surface Tension: 35.2 dyne/cm; (12)Enthalpy of Vaporization: 46.84 kJ/mol; (13)Vapour Pressure: 0.0614 mmHg at 25°C. Preparation: This chemical can be prepared by the reaction of but-3-en-2-one and nitromethane. This reaction needs reagent KF/basic alumina and solvent tetrahydrofuran. The reaction time is 1.5 hours. The yield is 83%. Uses: This chemical can prepare 5-nitro-pentan-2-ol. This reaction needs reagent sodium borate and aqueous methanol. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
