| Identification | |
| Name: | Propanenitrile,3-[[2-(acetyloxy)ethyl]phenylamino]- |
| Synonyms: | Propionitrile,3-(N-2-hydroxyethylanilino)-, acetate (6CI);Propionitrile,3-[N-(2-hydroxyethyl)anilino]-, acetate (ester) (8CI);N-(2-Acetoxyethyl)-N-(2-cyanoethyl)aniline;N-(b-Acetoxyethyl)-N-(b-cyanoethyl)aniline;N-Cyanoethyl-N-acetoxyethylaniline; |
| CAS: | 22031-33-0 |
| EINECS: | 244-740-4 |
| Molecular Formula: | C13H16N2O2 |
| Molecular Weight: | 232.28 |
| InChI: | InChI=1/C13H16N2O2/c1-12(16)17-11-10-15(9-5-8-14)13-6-3-2-4-7-13/h2-4,6-7H,5,9-11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.123 g/cm3 |
| Refractive index: | 1.545 |
| Solubility: | Soluble in water and ethanol, ether and other organic solvents |
| Appearance: | Colorless to white crystals |
| Specification: |
Propanenitrile,3-[[2-(acetyloxy)ethyl]phenylamino]- , its cas register number is 22031-33-0. It also can be called 3-((2-(Acetyloxy)ethyl)phenylamino)propanenitrile ; Aniline, N-acetoxyethyl-N-cyanoethyl- ; N-Acetoxyethyl-N-cyanoethylaniline ; Propanenitrile, 3-((2-(acetyloxy)ethyl)phenylamino)- ; Propionitrile, 3-(N-(2-hydroxyethyl)anilino)-, acetate (ester) . |
| Safety Data | |
 |
|
