| Identification | |
| Name: | (R)-(+)-1-(4-Methoxyphenyl)ethylamine |
| Synonyms: | (R)-p-Methoxy-alpha-methylbenzylamine; (R)-(+)-1-(4-Methoxyphenyl)ethylamine; R(+)-1-(4-Methoxyphenyl)Ethyla |
| CAS: | 22038-86-4 |
| EINECS: | -0 |
| Molecular Formula: | C9H13NO |
| Molecular Weight: | 151.21 |
| InChI: | InChI=1/C9H13NO/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7H,10H2,1-2H3/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Melting Point: | <-20°C |
| Flash Point: | 99.3°C |
| Boiling Point: | 65°C 0,4mm |
| Density: | 1.024 |
| Refractive index: | 1.533 |
| Alpha: | 32 º (NEAT) |
| Specification: |
(R)-(+)-1-(4-Methoxyphenyl)ethylamine ,its cas register number is 22038-86-4. It also can be called (R)-p-Methoxy-ethylbenzylamine ; (R)-(+)-4-Methoxy-alpha-methylbenzylamine and benzenemethanamine, 4-methoxy-alpha-methyl- . |
| Packinggroup: | III |
| Flash Point: | 99.3°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
