Identification |
Name: | Cyclopenta[c]furo[3',2':4,5]furo[2,3-h][1]benzopyran-1,11-dione,2,3,6a,8,9,9a-hexahydro-4-methoxy- |
Synonyms: | 1-Cyclopentene-1-carboxylicacid, 5-oxo-2-(2,3,3a,8a-tetrahydro-4-hydroxy-6-methoxyfuro[2,3-b]benzofuran-5-yl)-,d-lactone (7CI) |
CAS: | 22040-96-6 |
Molecular Formula: | C17H14 O6 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C17H14O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h6,8,17H,2-5H2,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 286-289 deg C |
Flash Point: | 234°C |
Boiling Point: | 521°Cat760mmHg |
Density: | 1.52g/cm3 |
Flash Point: | 234°C |
Color: | Colorless to pale yellow crystals CRYSTALS FROM CHLOROFORM & PENTANE Yellow crystals with blue fluorescence. |
Safety Data |
|
|