Identification |
Name: | 1,2-Dicarbadodecaboran(12)-3-amine |
Synonyms: | 1,2-Dicarbadodecaborane(12),3-amino- (8CI); 3-Amino-o-carborane |
CAS: | 22043-65-8 |
Molecular Formula: | C2H13 B10 N |
Molecular Weight: | 0 |
InChI: | InChI=1S/C7H15N3O2S2.ClH/c1-10(2)5(3-13-6(8)11)4-14-7(9)12;/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12);1H |
Molecular Structure: |
 |
Properties |
Melting Point: | 179 deg C to 181 deg C (with decomposition) |
Solubility: | In water at 25 deg C, approx 200 g/l. Very slightly soluble in methanol and ethanol. Insoluble in acetone, diethyl ether, ethyl acetate, chloroform, benzene, and n-hexane. |
Color: | Colorless crystalline, slightly hygroscopic solid |
Safety Data |
|
 |