| Identification | |
| Name: | 2-Propenoic acid,2-chloroethyl ester |
| Synonyms: | Acrylicacid, 2-chloroethyl ester (6CI,7CI,8CI); Ethanol, 2-chloro-, acrylate (8CI);2-Chloroethyl acrylate; Acrylic acid b-chloroethyl ester; Chloroethyl acrylate; NSC 18592;NSC 65162; b-Chloroethyl acrylate |
| CAS: | 2206-89-5 |
| EINECS: | 218-619-1 |
| Molecular Formula: | C5H7 Cl O2 |
| Molecular Weight: | 134.57 |
| InChI: | InChI=1/C5H7ClO2/c1-2-5(7)8-4-3-6/h2H,1,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 67.8°C |
| Boiling Point: | 64-66°C 20mm |
| Density: | 1.111g/cm3 |
| Refractive index: | 1.434 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 67.8°C |
| Safety Data | |
 |
|
