| Identification | |
| Name: | Benzeneacetic acid, a-diazo-, ethyl ester |
| Synonyms: | Aceticacid, diazophenyl-, ethyl ester (8CI);Ethyl 2-diazo-2-phenylacetate;Ethyldiazophenylacetate;Ethyl phenyldiazoacetic acid;Ethyl a-diazophenylacetate; |
| CAS: | 22065-57-2 |
| Molecular Formula: | C10H10N2O2 |
| Molecular Weight: | 190.2 |
| InChI: | InChI=1/C10H10N2O2/c1-2-14-10(13)9(12-11)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The Ethyl diazophenylacetate, with the CAS registry number 22065-57-2, is also called benzeneacetic acid, α-diazo-, ethyl ester. And the molecular formula of the chemical is C10H10N2O2. The characteristics of Ethyl diazophenylacetate are as followings: (1)ACD/LogP: 2.26; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 4; (6)ACD/BCF (pH 7.4): 4; (7)ACD/KOC (pH 5.5): 89; (8)ACD/KOC (pH 7.4): 89; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 26.3 Å2. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
