| Identification |
| Name: | Benzeneacetic acid,3-benzoyl- |
| Synonyms: | Aceticacid, (m-benzoylphenyl)- (8CI); (3-Benzoylphenyl)acetic acid;2-(3-Benzoylphenyl)acetic acid; RU 4462; m-Benzoylphenylacetic acid |
| CAS: | 22071-22-3 |
| EINECS: | 244-760-3 |
| Molecular Formula: | C15H12 O3 |
| Molecular Weight: | 240.25 |
| InChI: | InChI=1/C15H12O3/c16-14(17)10-11-5-4-8-13(9-11)15(18)12-6-2-1-3-7-12/h1-9H,10H2,(H,16,17) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 111°C |
| Flash Point: | 233.1°C |
| Boiling Point: | 438.5°Cat760mmHg |
| Density: | 1.232g/cm3 |
| Refractive index: | 1.605 |
| Flash Point: | 233.1°C |
| Usage: | Shows antiinflammatory and analgesic activities. It can be used as neoplasm inhibitors and for treatment of angiogenesis-related disorders |
| Safety Data |
| |
 |
