Identification |
Name: | 1-Butanol,2-[[6-[(3-amino-5-chlorophenyl)amino]-9-(1-methylethyl)-9H-purin-2-yl]amino]-3-methyl-,(2R)- |
Synonyms: | AminopurvalanolA; NG 97 |
CAS: | 220792-57-4 |
Molecular Formula: | C19H26 Cl N7 O |
Molecular Weight: | 403.91 |
InChI: | InChI=1/C19H26ClN7O/c1-10(2)15(8-28)24-19-25-17(23-14-6-12(20)5-13(21)7-14)16-18(26-19)27(9-22-16)11(3)4/h5-7,9-11,15,28H,8,21H2,1-4H3,(H2,23,24,25,26)/t15-/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 340.2°C |
Boiling Point: | 639°Cat760mmHg |
Density: | 1.4g/cm3 |
Refractive index: | 1.678 |
Biological Activity: | Cell-permeable cyclin-dependent kinase inhibitor. IC 50 values are 0.033, 0.033, 0.028 and 0.020 μ M for cdk1/cyclin B, cdk2/cyclin A, cdk2/cyclin E, and cdk5/p35 respectively. Inhibits ERK1 (IC 50 = 12.0 μ M) and ERK2 (IC 50 = 3.1 μ M) and is 3000-fold selective over a range of other protein kinases (IC 50 > 100 μ M). Arrests cell cycle at G 2 /M boundary (IC 50 = 1.25 μ M), and induces apoptosis at concentrations > 10 μ M. |
Flash Point: | 340.2°C |
Safety Data |
|
|