| Identification | |
| Name: | Ethanimidic acid, ethylester, hydrochloride (1:1) |
| Synonyms: | Acetimidicacid, ethyl ester, hydrochloride (6CI,7CI,8CI);Ethanimidic acid, ethyl ester,hydrochloride (9CI);Ethyl acetoamidatehydrochloride;Ethyl acetocarboximidate hydrochloride;Ethyl acetoimidatehydrochloride;Ethyl ethanimidate hydrochloride;Ethyl iminoacetatehydrochloride; |
| CAS: | 2208-07-3 |
| EINECS: | 218-631-7 |
| Molecular Formula: | C4H10ClNO |
| Molecular Weight: | 123.58 |
| InChI: | InChI=1/C4H9NO.ClH/c1-3-6-4(2)5;/h5H,3H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.89g/cm3 |
| Refractive index: | 1.58 (20 C) |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Ethanimidic acid, ethylester, hydrochloride (1:1) , with CAS number of 2208-07-3, can be called 1-Ethoxyethaniminium chloride ; Ethyl ethanimidoate hydrochloride (1:1) . It is a white to light yellow crystal powder. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
