| Identification |
| Name: | L-Ornithine,N5-[(dimethylamino)iminomethyl]-, hydrochloride (1:2) |
| Synonyms: | L-Ornithine,N5-[(dimethylamino)iminomethyl]-, dihydrochloride (9CI) |
| CAS: | 220805-22-1 |
| Molecular Formula: | C8H18 N4 O2 . 2 Cl H |
| Molecular Weight: | 275.18 |
| InChI: | InChI=1/C8H18N4O2.2ClH/c1-12(2)8(10)11-5-3-4-6(9)7(13)14;;/h6H,3-5,9H2,1-2H3,(H2,10,11)(H,13,14);2*1H/t6-;;/m0../s1 |
| Molecular Structure: |
![(C8H18N4O2.2ClH) L-Ornithine,N5-[(dimethylamino)iminomethyl]-, dihydrochloride (9CI)](https://img1.guidechem.com/chem/e/dict/142/220805-22-1.jpg) |
| Properties |
| Melting Point: | 202-204OC |
| Flash Point: | 212.4°C |
| Boiling Point: | 427.5°C at 760 mmHg |
| Flash Point: | 212.4°C |
| Usage: | A potent inhibitor of NO synthase of adrenal glands, brain, and vascular endothelial cells |
| Safety Data |
| |
 |
