| Identification |
| Name: | 2H-Indol-2-one,3-[(3,5-dibromo-4-hydroxyphenyl)methylene]-1,3-dihydro-5-iodo- |
| Synonyms: | (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-iodo-1,3-dihydro-2H-indol-2-one;5-Iodo-3-((3, 5-dibromo-4-hydroxyphenyl)methylene)-2-indolinone; |
| CAS: | 220904-83-6 |
| Molecular Formula: | C15H8Br2INO2 |
| Molecular Weight: | 520.94 |
| InChI: | InChI=1/C15H8Br2INO2/c16-11-4-7(5-12(17)14(11)20)3-10-9-6-8(18)1-2-13(9)19-15(10)21/h1-6,20H,(H,19,21)/b10-3- |
| Molecular Structure: |
![(C15H8Br2INO2) (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-iodo-1,3-dihydro-2H-indol-2-one;5-Iodo-3-((3, 5-...](https://img1.guidechem.com/chem/e/dict/16/220904-83-6.jpg) |
| Properties |
| Flash Point: | 293.3°C |
| Boiling Point: | 561.4°Cat760mmHg |
| Density: | 2.248g/cm3 |
| Refractive index: | 1.789 |
| Solubility: | soluble in DMSO |
| Appearance: | solid |
| Biological Activity: | Potent, selective and cell-permeable c-Raf1 kinase inhibitor (IC 50 = 9 nM). Displays ≥ 100-fold selectivity for raf kinase over CDK1, CDK2, c-src, ERK2, MEK, p38, Tie2, VEGFR2 and c-fm. |
| Flash Point: | 293.3°C |
| Storage Temperature: | -20°C |
| Safety Data |
| |
 |
