Identification |
Name: | b-D-Glucopyranosiduronic acid,2-[(phenylmethoxy)carbonyl]phenyl, methyl ester, triacetate (9CI) |
Synonyms: | 2-[(Phenylmethoxy)carbonyl]phenyl -D-Glucopyranosiduronic Acid Methyl Ester Triacetate;Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl--D-glucopyranuronate |
CAS: | 221287-88-3 |
Molecular Formula: | C27H28 O12 |
Molecular Weight: | 0 |
InChI: | InChI=1/C27H28O12/c1-15(28)35-21-22(36-16(2)29)24(37-17(3)30)27(39-23(21)26(32)33-4)38-20-13-9-8-12-19(20)25(31)34-14-18-10-6-5-7-11-18/h5-13,21-24,27H,14H2,1-4H3/t21-,22-,23?,24-,27+/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 258.702°C |
Boiling Point: | 612.873°C at 760 mmHg |
Density: | 1.347g/cm3 |
Refractive index: | 1.564 |
Flash Point: | 258.702°C |
Usage: | An intermediate in the synthesis of the metabolite of Nitazoxanide |
Safety Data |
|
|