Identification |
Name: | 4(1H)-Pteridinone,2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]- |
Synonyms: | 4(1H)-Pteridinone,2-amino-6-(1,2-dihydroxypropyl)-, [S-(R*,S*)]-;4(3H)-Pteridinone,2-amino-6-(L-erythro-1,2-dihydroxypropyl)- (7CI,8CI);(-)-Biopterin;Biopterin;L-Biopterin;L-erythro-Biopterin;NSC 339699;Pterin HB2; |
CAS: | 22150-76-1 |
EINECS: | 244-807-8 |
Molecular Formula: | C9H11N5O3 |
Molecular Weight: | 237.22 |
InChI: | InChI=1/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) |
Molecular Structure: |
![(C9H11N5O3) 4(1H)-Pteridinone,2-amino-6-(1,2-dihydroxypropyl)-, [S-(R*,S*)]-;4(3H)-Pteridinone,2-amino-6-(L-eryt...](https://img.guidechem.com/casimg/22150-76-1.gif) |
Properties |
Density: | 1.86 g/cm3 |
Refractive index: | 1.821 |
Appearance: | Crystalline solid |
Storage Temperature: | 2-8°C |
Usage: | A pteridine widely distributed in nature; naturally occurring as the L-erythro-form. Considered as a growth factor for some insects. Fluoresces with a blue color in alkaline solution. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |