| Identification | |
| Name: | 2,6,7-Trioxa-1-arsabicyclo[2.2.2]octane,4-methyl- |
| Synonyms: | 1,3-Propanediol,2-(hydroxymethyl)-2-methyl-, cyclic arsenite (6CI,7CI); 1,3-Propanediol,2-(hydroxymethyl)-2-methyl-, cyclic ester with arsenious acid (H3AsO3) (1:1)(8CI) |
| CAS: | 22223-55-8 |
| Molecular Formula: | C5H9 As O3 |
| Molecular Weight: | 192.06 |
| InChI: | InChI=1/C5H9AsO3/c1-5-2-7-6(8-3-5)9-4-5/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 35.2°C |
| Boiling Point: | 143.2°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
4-Methyl-2,6,7-trioxa-1-arsabicyclo(2.2.2)octane , its CAS NO. is 22223-55-8, the synonyms are BRN 1904406 ; 2,6,7-Trioxa-1-arsabicyclo(2.2.2)octane, 4-methyl- . |
| Flash Point: | 35.2°C |
| Safety Data | |
 |
|
