| Identification | |
| Name: | Propanoic acid,2-methyl-, ammonium salt (1:1) |
| Synonyms: | Isobutyricacid, ammonium salt (8CI); Propanoic acid, 2-methyl-, ammonium salt (9CI);Ammonium isobutyrate |
| CAS: | 22228-82-6 |
| EINECS: | 244-850-2 |
| Molecular Formula: | C4H8 O2 . H3 N |
| Molecular Weight: | 105.13564 |
| InChI: | InChI=1/C4H8O2.H3N/c1-3(2)4(5)6;/h3H,1-2H3,(H,5,6);1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -47 deg C |
| Flash Point: | 58.2°C |
| Boiling Point: | 155.2°C at 760 mmHg |
| Solubility: | Slightly soluble in carbon tetrachloride Sol in 6 parts of water; miscible with alcohol, chloroform, and ether. In water, 1.67X10+5 mg/L at 20 deg C |
| Flash Point: | 58.2°C |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
