| Identification | |
| Name: | bis(2-aminoethoxy)borinic acid |
| Synonyms: | Ethanol, 2-amino-, 1,1'-diester with boric acid (H3BO3);Bis(2-aminoethyl)borate;Boric acid, monoethanolamine diester;Caswell No. 088;Bis(2-aminoethanol), diester with boric acid;Ethanol, 2-amino-, diester with boric acid (H3BO3);bis(2-aminoethyl) hydrogen borate |
| CAS: | 22232-01-5 |
| EINECS: | 244-852-3 |
| Molecular Formula: | C4H13BN2O3 |
| Molecular Weight: | 147.9686 |
| InChI: | InChI=1/C4H13BN2O3/c6-1-3-9-5(8)10-4-2-7/h8H,1-4,6-7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 101°C |
| Boiling Point: | 243.4°C at 760 mmHg |
| Density: | 1.103g/cm3 |
| Refractive index: | 1.45 |
| Flash Point: | 101°C |
| Safety Data | |
 |
|
