| Identification | |
| Name: | Benzoic acid,4-[(1S)-1-aminoethyl]-, methyl ester |
| Synonyms: | 4-[(1S)-1-Aminoethyl]benzoic acid methyl ester; |
| CAS: | 222714-37-6 |
| Molecular Formula: | C10H13NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H13NO2/c1-7(11)8-3-5-9(6-4-8)10(12)13-2/h3-7H,11H2,1-2H3/t7-/m0/s1 |
| Molecular Structure: | ![(C10H13NO2) 4-[(1S)-1-Aminoethyl]benzoic acid methyl ester;](https://img1.guidechem.com/chem/e/dict/24/222714-37-6.jpg) |
| Properties | |
| Density: | 1.089 g/cm3 |
| Refractive index: | 1.533 |
| Specification: |
The 4-[(1S)-1-Aminoethyl]benzoic acid methyl ester with the cas number 222714-37-6 is also called Benzoic acid,4-[(1S)-1-aminoethyl]-, methyl ester. The systematic name is methyl 4-[(1S)-1-aminoethyl]benzoate. Its molecular formula is C10H13NO2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.41; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 52.32Å2; (7)Index of Refraction: 1.533; (8)Molar Refractivity: 51.11 cm3; (9)Molar Volume: 164.5 cm3; (10)Polarizability: 20.26×10-24cm3; (11)Surface Tension: 40.9 dyne/cm; (12)Enthalpy of Vaporization: 52.03 kJ/mol; (13)Vapour Pressure: 0.00354 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
