| Identification | |
| Name: | 4-Pyridinol, 3-fluoro- |
| Synonyms: | 3-FLUORO-4-HYDROXYPYRIDINE;3-FLUORO-4-PYRIDINOL;3-Fluoro-4-hydroxypyridine97%;3-FLUORO-4-HYDROXYPYRIDINE 97%;3-Fluoropyridin-4-ol |
| CAS: | 22282-73-1 |
| Molecular Formula: | C5H4 F N O |
| Molecular Weight: | 113.09 |
| InChI: | InChI=1/C5H4FNO/c6-4-3-7-2-1-5(4)8/h1-3H,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.26g/cm3 |
| Refractive index: | 1.508 |
| Specification: |
The 3-Fluoro-4-hydroxypyridine with its cas register number is 22282-73-1. It also can be called as 4-Pyridinol, 3-fluoro- and the Systematic name about this chemical is 3-fluoropyridin-4(1H)-one. Physical properties about 3-Fluoro-4-hydroxypyridine are: (1)ACD/LogP: -1.07; (2)ACD/LogD (pH 5.5): -1.06; (3)ACD/LogD (pH 7.4): -1.07; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 6.28; (7)ACD/KOC (pH 7.4): 6.16; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)Polar Surface Area: 20.31Å2; (11)Index of Refraction: 1.508; (12)Molar Refractivity: 26.62 cm3; (13)Molar Volume: 89.2 cm3; (14)Polarizability: 10.55x10-24cm3; (15)Surface Tension: 33.4 dyne/cm; (16)Enthalpy of Vaporization: 41.18 kJ/mol; (17)Vapour Pressure: 1.14 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
