Identification |
Name: | 2',4'-Dichloroacetophenone |
Synonyms: | 1-(2,4-Dichlorophenyl)ethanone; 2,4-Dichloroacetophenone; 2,4-Dichlopoacetophenone; 2,4-Dicloro actophenone; 2,4-Dichloroaceophenone |
CAS: | 2234-16-4 |
EINECS: | 218-780-8 |
Molecular Formula: | C8H6Cl2O |
Molecular Weight: | 189.04 |
InChI: | InChI=1/C8H6Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-4H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 50 |
Density: | 1.32 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5635 |
Water Solubility: | ca. 200 mg/L |
Solubility: | SOLVENT |
Appearance: | white to off-white crystals |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |