| Identification |
| Name: | 2',4'-Dichloroacetophenone |
| Synonyms: | 1-(2,4-Dichlorophenyl)ethanone; 2,4-Dichloroacetophenone; 2,4-Dichlopoacetophenone; 2,4-Dicloro actophenone; 2,4-Dichloroaceophenone |
| CAS: | 2234-16-4 |
| EINECS: | 218-780-8 |
| Molecular Formula: | C8H6Cl2O |
| Molecular Weight: | 189.04 |
| InChI: | InChI=1/C8H6Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 50 |
| Density: | 1.32 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5635 |
| Water Solubility: | ca. 200 mg/L |
| Solubility: | SOLVENT |
| Appearance: | white to off-white crystals |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
