| Identification | |
| Name: | 2H-Azepin-2-one,1-ethenylhexahydro- |
| Synonyms: | 2H-Azepin-2-one,hexahydro-1-vinyl- (6CI,7CI,8CI);1-Vinylcaprolactam;N-Vinyl-e-caprolactam;N-Vinylazepan-2-one;1-vinylhexahydro-2h-azepin-2-one;1-ethenylazepan-2-one;Vinylcaprolactam;n-vinyl-epsilon-caprolactam; |
| CAS: | 2235-00-9 |
| EINECS: | 218-787-6 |
| Molecular Formula: | C8H13NO |
| Molecular Weight: | 139.19 |
| InChI: | InChI=1/C8H13NO/c1-2-9-7-5-3-4-6-8(9)10/h2H,1,3-7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 214? |
| Density: | 1.029 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1. |
| Appearance: | Light yellow powder |
| Specification: |
2H-Azepin-2-one,1-ethenylhexahydro- , with CAS number of 2235-00-9, can be called 1-vinylhexahydro-2h-azepin-2-one ; 1-ethenylazepan-2-one ; 1-ethenylhexahydro-2h-azepin-2-one ; vinylcaprolactam ; n-vinyl-epsilon-caprolactam ; n-vinylcaprolactam ; 1-ethenylhexahydro-2h-azepin-2-on ; 2h-azepin-2-one, 1-ethenylhexahydro- . |
| Flash Point: | 214? |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
