| Identification | |
| Name: | Butanamide,N,N-diethyl-3-oxo- |
| Synonyms: | Acetoacetamide,N,N-diethyl- (7CI,8CI); 1-(Diethylcarbamoyl)-2-propanone;Diethylacetoacetamide; N,N-Diethyl-3-oxobutanamide; N,N-Diethylacetoacetamide;N,N-Diethylacetylacetamide; N-Diethylacetoacetamide; Promotor C |
| CAS: | 2235-46-3 |
| EINECS: | 218-792-3 |
| Molecular Formula: | C8H15 N O2 |
| Molecular Weight: | 157.21 |
| InChI: | InChI=1/C8H15NO2/c1-4-9(5-2)8(11)6-7(3)10/h4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.994 |
| Refractive index: | 1.471 |
| Solubility: | SOLUBLE IN WATER |
| Appearance: | yellow |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | yellow |
| Usage: | N,N-Diethylacetoacetamide is used as intermediate for the manufacture of insecticides, e.g. phosphamidon Product Data Sheet |
| Safety Data | |
 |
|
