| Identification | |
| Name: | Benzaldehyde,3-chloro-2-methoxy- |
| Synonyms: | 3-Chloro-2-methoxybenzaldehyde |
| CAS: | 223778-54-9 |
| Molecular Formula: | C8H7 Cl O2 |
| Molecular Weight: | 170.59 |
| InChI: | InChI=1/C8H7ClO2/c1-11-8-6(5-10)3-2-4-7(8)9/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.244 g/cm3 |
| Refractive index: | 1.564 |
| Specification: |
The 3-Chloro-2-methoxybenzaldehyde, with the CAS registry number 223778-54-9, is also known as Benzaldehyde, 3-chloro-2-methoxy-. This chemical's molecular formula is C8H7ClO2 and molecular weight is 170.59. Its systematic name is called 3-Chloro-2-methoxybenzaldehyde. Physical properties of 3-Chloro-2-methoxybenzaldehyde: (1)ACD/LogP: 2.28; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.28; (4)ACD/LogD (pH 7.4): 2.28; (5)ACD/BCF (pH 5.5): 31.85; (6)ACD/BCF (pH 7.4): 31.85; (7)ACD/KOC (pH 5.5): 414.51; (8)ACD/KOC (pH 7.4): 414.51; (9)#H bond acceptors: 2; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.564; (12)Molar Refractivity: 44.57 cm3; (13)Molar Volume: 137 cm3; (14)Surface Tension: 40 dyne/cm; (15)Density: 1.244 g/cm3; (16)Flash Point: 116 °C; (17)Enthalpy of Vaporization: 49.88 kJ/mol; (18)Boiling Point: 261.1 °C at 760 mmHg; (19)Vapour Pressure: 0.0118 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
