| Identification | |
| Name: | Ethanone,2-(acetyloxy)-1-phenyl- |
| Synonyms: | Acetophenone,2-hydroxy-, acetate (6CI,7CI,8CI);2-Acetoxyacetophenone;2-Hydroxyacetophenoneacetate;Acetic acid 2-oxo-2-phenylethyl ester;NSC 9837;a-Acetoxyacetophenone;w-Acetoxyacetophenone; |
| CAS: | 2243-35-8 |
| EINECS: | -0 |
| Molecular Formula: | C10H10O3 |
| Molecular Weight: | 178.19 |
| InChI: | InChI=1/C10H10O3/c1-7(11)9-5-3-4-6-10(9)13-8(2)12/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 |
| Melting Point: | 48-50°C |
| Flash Point: | >110°C |
| Boiling Point: | 110-114°C 2mm |
| Density: | 1.229g/cm3 |
| Refractive index: | 1.473 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | >110°C |
| Safety Data | |
 |
|
