| Identification | |
| Name: | 2,4,5,6(1H,3H)-Pyrimidinetetrone,hydrate (1:1) |
| Synonyms: | 2,4,5,6(1H,3H)-Pyrimidinetetrone,monohydrate (9CI); |
| CAS: | 2244-11-3 |
| EINECS: | 200-062-0 |
| Molecular Formula: | C4H2N2O4.H2O |
| Molecular Weight: | 160.08 |
| InChI: | InChI=1/C4H2N2O4.H2O/c7-1-2(8)5-4(10)6-3(1)9;/h(H2,5,6,8,9,10);1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.681g/cm3 |
| Water Solubility: | H2O: may be hazy yellow |
| Solubility: | H2O: may be hazy yellow |
| Specification: |
Mesoxalylurea monohydrate ,its CAS NO. is 2244-11-3,the synonyms is 2,4,5,6(1H,3h)-pyrimidinetetronehydrate ; 2,4,5,6-Tetraoxohexahydropyrimidinehydrate ; Mesoxalylcarbamidemonohydrate ; Labotest-bb lt00138148 ; Mesoxalylurea ; Mesoxalylurea, monohydrate ; 2,4,5,6-Tetraoxypyrimidine ; 2,4,5,6-Tetraoxypyrimidine monohydrate . |
| HS Code: | 29335995 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Color: | Orthorhombic crystals from anhydrous acetone or glacial acetic acid or by sublimation in vacuo. Turns pink at 230 deg C ... Hot aqueous solutions are yellow and become colorless on cooling |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
