| Identification | |
| Name: | 4-Pyridinamine,3-fluoro- |
| Synonyms: | Pyridine,4-amino-3-fluoro- (7CI,8CI);3-Fluoro-4-aminopyridine;3-Fluoropyridin-4-amine;4-Amino-3-fluoropyridine;3-Fluoropyridin-4-amine; |
| CAS: | 2247-88-3 |
| Molecular Formula: | C5H5FN2 |
| Molecular Weight: | 112.1 |
| InChI: | InChI=1/C5H5FN2/c6-4-3-8-2-1-5(4)7/h1-3H,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 74-77oC |
| Flash Point: | 85.1 oC |
| Boiling Point: | 217.1 oC at 760 mmHg |
| Density: | 1.257 g/cm3 |
| Refractive index: | 1.554 |
| Appearance: | Yellow to light yellow crystals |
| Specification: |
? 3-Fluoropyridin-4-amine , with CAS number of 2247-88-3, can be called 4-pyridinamine, 3-fluoro- ; 3-fluoro-4-aminopyridine ; 4-Amino-3-fluoropyridine . It is a?yellow to light yellow crystal. |
| Flash Point: | 85.1 oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
