| Identification | |
| Name: | Benzene,1-(2-methoxyethoxy)-4-nitro- |
| Synonyms: | Ethane,1-methoxy-2-(p-nitrophenoxy)- (8CI);1-(2-Methoxyethoxy)-4-nitrobenzene;1-Methoxy-2-(p-nitrophenoxy)ethane; |
| CAS: | 22483-40-5 |
| Molecular Formula: | C18H20N2O7 |
| Molecular Weight: | 376.3606 |
| InChI: | InChI=1/C9H11NO4/c1-13-6-7-14-9-4-2-8(3-5-9)10(11)12/h2-5H,6-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.283 g/cm3 |
| Refractive index: | 1.525 |
| Specification: |
The 4-Nitrophenyl-2-methoxyethyl ether, with the CAS registry number 22483-40-5, has the systematic name of benzene, 1,1'-[oxybis(2-methoxyethylidene)]bis[4-nitro-. And the molecular formula of the chemical is C18H20N2O7. The characteristics of 4-Nitrophenyl-2-methoxyethyl ether are as followings: (1)ACD/LogP: 2.95; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.95; (4)ACD/LogD (pH 7.4): 2.95; (5)ACD/BCF (pH 5.5): 103.18; (6)ACD/BCF (pH 7.4): 103.18; (7)ACD/KOC (pH 5.5): 961.47; (8)ACD/KOC (pH 7.4): 961.47; (9)#H bond acceptors: 9; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 10; (12)Polar Surface Area: 119.33 Å2; (13)Index of Refraction: 1.576; (14)Molar Refractivity: 97.15 cm3; (15)Molar Volume: 293.2 cm3; (16)Polarizability: 38.51×10-24cm3; (17)Surface Tension: 50.6 dyne/cm; (18)Density: 1.283 g/cm3; (19)Flash Point: 196.2 °C; (20)Enthalpy of Vaporization: 74.39 kJ/mol; (21)Boiling Point: 503.8 °C at 760 mmHg; (22)Vapour Pressure: 8.8E-10 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
