| Identification | |
| Name: | 1,3-Benzenedicarboxylicacid, anhydride with diethane carbonate |
| Synonyms: | 1,3-Benzenedicarboxylicacid, dianhydride with ethyl hydrogen carbonate (9CI); Isophthalic acid, dianhydridewith EtHCO3 (7CI); Isophthalic acid, dianhydride with ethyl carbonate (8CI);Carbonic acid, anhydride with isophthalic acid (2:1), diethyl ester (8CI);Isophthalic acid dianhydride with monoethyl carbonate; Isophthalic aciddicarboxylic acid ethyl ester anhydride |
| CAS: | 22483-52-9 |
| EINECS: | 245-027-0 |
| Molecular Formula: | C14H14 O8 |
| Molecular Weight: | 310.2562 |
| InChI: | InChI=1/C14H14O8/c1-3-19-13(17)21-11(15)9-6-5-7-10(8-9)12(16)22-14(18)20-4-2/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.5°C |
| Boiling Point: | 419.4°Cat760mmHg |
| Density: | 1.302g/cm3 |
| Refractive index: | 1.515 |
| Flash Point: | 185.5°C |
| Safety Data | |
 |
|
