| Identification | |
| Name: | Pyrimidine,2-chloro-5-methoxy- |
| Synonyms: | 2-Chloro-5-methoxypyrimidine |
| CAS: | 22536-65-8 |
| Molecular Formula: | C5H5ClN2O |
| Molecular Weight: | 144.56 |
| InChI: | InChI=1/C5H5ClN2O/c1-9-4-2-7-5(6)8-3-4/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.3°C |
| Boiling Point: | 268.8°Cat760mmHg |
| Density: | 1.292g/cm3 |
| Refractive index: | 1.52 |
| Specification: |
2-Chloro-5-methoxypyrimidine , with CAS number of 22536-65-8, can be called pyrimidine, 2-chloro-5-methoxy- ; 2-Chlor-5-methoxypyrimidin . |
| Flash Point: | 116.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
