| Identification | |
| Name: | Quinoline,8-chloro-5-nitro- |
| Synonyms: | 5-Nitro-8-chloroquinoline;8-Chloro-5-nitroquinoline;NSC 74384; |
| CAS: | 22539-55-5 |
| Molecular Formula: | C9H5ClN2O2 |
| Molecular Weight: | 208.60 |
| InChI: | InChI=1/C9H5ClN2O2/c10-7-3-4-8(12(13)14)6-2-1-5-11-9(6)7/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.484 g/cm3 |
| Refractive index: | 1.688 |
| Specification: |
The 8-Chloro-5-nitroquinoline with its cas register number is 22539-55-5. It also can be called as Quinoline,8-chloro-5-nitro- and the IUPAC Name about this chemical is 8-chloro-5-nitroquinoline. Physical properties about 8-Chloro-5-nitroquinoline are: (1)#H bond acceptors: 4; (2)#Freely Rotating Bonds: 1; (3)Polar Surface Area: 58.71Å2; (4)Index of Refraction: 1.688; (5)Molar Refractivity: 53.62 cm3; (6)Molar Volume: 140.5 cm3; (7)Polarizability: 21.25x10-24cm3; (8)Surface Tension: 63.3 dyne/cm; (9)Enthalpy of Vaporization: 57.49 kJ/mol; (10)Vapour Pressure: 7.24E-05 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
