| Identification | |
| Name: | 1,2,4-Thiadiazole,3,5-dichloro- |
| Synonyms: | 3,5-Dichloro-1,2,4-thiadiazole; |
| CAS: | 2254-88-8 |
| Molecular Formula: | C2Cl2N2S |
| Molecular Weight: | 155.01 |
| InChI: | InChI=1/C2Cl2N2S/c3-1-5-2(4)7-6-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 105.1°C |
| Boiling Point: | 250.1°Cat760mmHg |
| Density: | 1.736g/cm3 |
| Refractive index: | 1.558-1.56 |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:36/37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 105.1°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
