Benzo[b]thiophene-6-ol,2-(4-methoxyphenyl)- (225648-21-5)

The systematic name of 2-(4-Methoxyphenyl)benzothiophene-6-ol is 2-(4-methoxyphenyl)-1-benzothiophene-6-ol . With the CAS registry number 225648-21-5, it is also named as 2-(4-Methoxyphenyl)-1-benzothiophene-6-ol ; Benzo[b]thiophene-6-ol, 2-(4-methoxyphenyl)- . After the analysis, we know H bond acceptors is 2 and H bond donors is 1. People can use the following data to convert to the molecule structure. SMILES: O(c3ccc(c2sc1cc(O)ccc1c2)cc3)C; InChI: InChI=1/C15H12O2S/c1-17-13-6-3-10(4-7-13)14-8-11-2-5-12(16)9-15(11)18-14/h2-9,16H,1H3;  InChIKey: VZUFJMKTXKURRI-UHFFFAOYAJ; Std. InChI: InChI=1S/C15H12O2S/c1-17-13-6-3-10(4-7-13)14-8-11-2-5-12(16)9-15(11)18-14/h2-9,16H,1H3; Std. InChIKey: VZUFJMKTXKURRI-UHFFFAOYSA-N.

 2-(4-Methoxyphenyl)benzothiophene-6-ol also has other properties. The index of refraction is 1.677, and molar refractivity is 75.632 cm³. Besides, its surface tension is 52.091 dyne/cm with 74.863 kJ/mol enthalpy of vaporization.   

 2-(4-Methoxyphenyl)benzothiophene-6-ol is pharmaceutical intermediates. It has marketed in China and many companies supply this product.