| Identification | |
| Name: | propyl [3-(dimethylamino)propyl]carbamate - 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile (1:1) hydrochloride |
| Synonyms: | Tattoo C;AC1MIWRR;1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro-, mixed with propyl (3-(dimethylamino)propyl)carbamate;1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro-, mixt. with propyl (3-(dimethylamino)propylcarbamate;226214-37-5;Carbamic acid, (3-(dimethylamino)propyl)-, propyl ester, monohydrochloride, mixt. With 2,4,5,6-tetrachloro-1,3-benzenedicarbonitrile;propyl N-[3-(dimethylamino)propyl]carbamate; 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile; hydrochloride |
| CAS: | 226214-37-5 |
| Molecular Formula: | C17H21Cl5N4O2 |
| Molecular Weight: | 490.6392 |
| InChI: | InChI=1/C9H20N2O2.C8Cl4N2.ClH/c1-4-8-13-9(12)10-6-5-7-11(2)3;9-5-3(1-13)6(10)8(12)7(11)4(5)2-14;/h4-8H2,1-3H3,(H,10,12);;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.8°C |
| Boiling Point: | 350.5°C at 760 mmHg |
| Flash Point: | 153.8°C |
| Safety Data | |
 |
|
