Identification |
Name: | Carbonic acid, thio-,anhydrosulfide with (3,4-dimethoxyphenethyl)dithiocarbamic acid, ethyl ester(8CI) |
Synonyms: | AC1MHUPZ;Carbonic acid, thio-, anhydrosulfide with (3,4-dimethoxyphenethyl)dithiocarbamic acid, ethyl ester;LS-52114;ethyl 2-(3,4-dimethoxyphenyl)ethylcarbamothioylsulfanylformate;22623-59-2 |
CAS: | 22623-59-2 |
Molecular Formula: | C14H19 N O4 S2 |
Molecular Weight: | 329.435 |
InChI: | InChI=1/C14H19NO4S2/c1-4-19-14(16)21-13(20)15-8-7-10-5-6-11(17-2)12(9-10)18-3/h5-6,9H,4,7-8H2,1-3H3,(H,15,20) |
Molecular Structure: |
 |
Properties |
Flash Point: | 222.8°C |
Boiling Point: | 444.8°Cat760mmHg |
Density: | 1.231g/cm3 |
Refractive index: | 1.574 |
Flash Point: | 222.8°C |
Safety Data |
|
 |