Identification |
Name: | Carbanilic acid,p-hydroxy-, methyl ester, methylcarbamate (ester) (8CI) |
Synonyms: | Carbamicacid, methyl-, ester with methyl p-hydroxycarbanilate (8CI); NSC 222495 |
CAS: | 22658-14-6 |
Molecular Formula: | C10H12 N2 O4 |
Molecular Weight: | 224.2133 |
InChI: | InChI=1/C10H12N2O4/c1-11-9(13)16-8-5-3-7(4-6-8)12-10(14)15-2/h3-6H,1-2H3,(H,11,13)(H,12,14) |
Molecular Structure: |
 |
Properties |
Flash Point: | 130.5°C |
Boiling Point: | 292.2°Cat760mmHg |
Density: | 1.278g/cm3 |
Refractive index: | 1.566 |
Flash Point: | 130.5°C |
Safety Data |
|
 |