| Identification |
| Name: | Ethanone,1-benzo[b]thien-2-yl- |
| Synonyms: | Ketone,benzo[b]thien-2-yl methyl (7CI,8CI);1-(Benzo[b]thiophen-2-yl)ethan-1-one;1-Benzo[b]thiophen-2-ylethanone;2-Acetylbenzothiophene; |
| CAS: | 22720-75-8 |
| EINECS: | 245-177-7 |
| Molecular Formula: | C10H8OS |
| Molecular Weight: | 176.23 |
| InChI: | InChI=1/C10H8OS/c1-7(11)10-6-8-4-2-3-5-9(8)12-10/h2-6H,1H3 |
| Molecular Structure: |
![(C10H8OS) Ketone,benzo[b]thien-2-yl methyl (7CI,8CI);1-(Benzo[b]thiophen-2-yl)ethan-1-one;1-Benzo[b]thiophen-2...](https://img.guidechem.com/casimg/22720-75-8.gif) |
| Properties |
| Melting Point: | 86-88ºC |
| Flash Point: | 138 ºC |
| Boiling Point: | 304.5 ºCat 760 mmHg |
| Density: | 1.219 g/cm3 |
| Refractive index: | 1.646 |
| Appearance: | white to light yellow crystal powder |
| Flash Point: | 138 ºC |
| Usage: | A novel anti-osteoporosis agent, by enhansing expression of the BMP-2 gene. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
