| Identification | |
| Name: | Thiohydroxylamine,S-(4-chlorophenyl)-N-[(2,4,5-trichlorophenyl)imino]- |
| Synonyms: | Diazene,[(4-chlorophenyl)thio](2,4,5-trichlorophenyl)- (9CI); Diimide, [(p-chlorophenyl)thio](2,4,5-trichlorophenyl)-(7CI,8CI); Benzenediazo phenyl sulfide, 2,4,4',5-tetrachloro- (8CI);2,4,5-Trichlorophenylazo-4'-chlorophenyl-sulfide; 4-Chlorophenyl2,4,5-trichlorophenylazo sulfide; Azosulfide; Benzenediazo p-chlorophenylsulfide, 2,4,5-trichloro-; CPAS; Chlorfensulfide;[(p-Chlorophenyl)thio](2,4,5-trichlorophenyl) diimide |
| CAS: | 2274-74-0 |
| Molecular Formula: | C12H6 Cl4 N2 S |
| Molecular Weight: | 352.06 |
| InChI: | InChI=1/C12H6Cl4N2S/c13-7-1-3-8(4-2-7)19-18-17-12-6-10(15)9(14)5-11(12)16/h1-6H/b18-17+ |
| Molecular Structure: | - (9CI); Diimide, [(p-chlorophenyl)thio](2,4,5-...](https://img1.guidechem.com/chem/e/dict/221/2274-74-0.jpg) |
| Properties | |
| Flash Point: | 239.1°C |
| Boiling Point: | 471.8°Cat760mmHg |
| Density: | 1.53g/cm3 |
| Refractive index: | 1.661 |
| Specification: |
Chlorfensulfide , its cas register number is 2274-74-0. It also can be called 2,4,5-Trichlorophenylazo-4'-chlorophenyl-sulfide ; 4-Chlorophenyl 2,4,5-trichlorophenylazosulfide ; Azosulfide ; BRN 1843651 ; Benzenediazo p-chlorophenyl sulfide, 2,4,5-trichloro- ; CPAS ; Chlorfensulphide and p-Chlorfenyl-2,4,5-trichlorfenylazosulfid .When heated to decomposition it emits very toxic fumes of Cl−, NOx, and SOx. The storage environment of Chlorfensulfide (CAS NO.2274-74-0) should be ventilate, low-temperature and dry and keep away from food. |
| Flash Point: | 239.1°C |
| Safety Data | |
 |
|
