| Identification | |
| Name: | Peroxide, acetyl nitro |
| Synonyms: | Peroxyaceticacid, anhydride with HNO3 (6CI); Peroxyacetyl nitrate (7CI,8CI); Acetylpernitrate; Acetyl peroxynitrate; Ethanone, 1-(nitrodioxy)-; Methylcarbonylperoxynitrate; Nitric acid, anhydride with ethaneperoxoic acid; PAN; PAN(oxidizing agent) |
| CAS: | 2278-22-0 |
| EINECS: | 218-905-6 |
| Molecular Formula: | C2H3 N O5 |
| Molecular Weight: | 121.06 |
| InChI: | InChI=1/C2H3NO5/c1-2(4)7-8-3(5)6/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 84.7°C |
| Boiling Point: | 156.4°Cat760mmHg |
| Density: | 1.438g/cm3 |
| Refractive index: | 1.41 |
| Solubility: | In water, 1.46X10+5 mg/L at 25 deg C (est) |
| Specification: |
Peroxyacetyl nitrate (CAS NO.2278-22-0) is a peroxyacyl nitrate. It is a secondary pollutant present in photochemical smog. |
| Flash Point: | 84.7°C |
| Color: | Unstable gas |
| Safety Data | |
 |
|
