| Identification | |
| Name: | Aspartame |
| CAS: | 22839-47-0 |
| EINECS: | 245-261-3 |
| Molecular Formula: | C14H18N2O5 |
| Molecular Weight: | 294.31 |
| InChI: | InChI=1/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m1/s1 |
| Molecular Structure: | ![(C14H18N2O5) r-Sweet;(3S)-3-amino-3-[[(1S)-1-methoxycarbonyl-2-phenyl-ethyl]carbamoyl]propanoic acid;Sweet cornSw...](https://img.guidechem.com/casimg/22839-47-0.gif) |
| Properties | |
| Density: | 1.28 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 15.5 o (C=4, 15N FORMIC ACID) |
| Solubility: | 18.2 g/L |
| Appearance: | White powder or tablets |
| Specification: |
The artificial sweetener Aspartame (CAS NO.22839-47-0) has been the subject of controversy since its initial approval by the U.S. Food and Drug Administration (FDA) in 1974. Concerns have been raised about the quality of the research supporting its safety and the long-term effects that increased consumption could have on the public. |
| Color: | Colorless needles from water Off-white crystalline powder |
| Usage: | A dipeptide ester about 160 times sweeter than sucrose in aqueous solution. A non-nutritive sweetener. |
| Safety Data | |
 |
|
