Identification |
Name: | N-(2,4-Difluorophenyl)-N'-[4-[(6,7-dimethoxy-4-quinolin yl)oxy]-2-fluorophenyl]urea |
Synonyms: | 1-(2,4-Di;N-(2,4-di;Urea, N-(;LogP |
CAS: | 228559-41-9 |
Molecular Formula: | C24H18F3N3O4 |
Molecular Weight: | 469.41 |
InChI: | InChI=1/C24H18F3N3O4/c1-32-22-11-15-20(12-23(22)33-2)28-8-7-21(15)34-14-4-6-19(17(27)10-14)30-24(31)29-18-5-3-13(25)9-16(18)26/h3-12H,1-2H3,(H2,29,30,31) |
Molecular Structure: |
|
Properties |
Flash Point: | 254.4°C |
Boiling Point: | 497.1°C at 760 mmHg |
Density: | 1.429g/cm3 |
Refractive index: | 1.656 |
Water Solubility: | Soluble to 100 mM in DMSO |
Solubility: | Soluble to 100 mM in DMSO |
Flash Point: | 254.4°C |
Safety Data |
|
|