| Identification |
| Name: | D-Mannitol,1-amino-2,5-anhydro-1-deoxy- |
| Synonyms: | 1-Amino-2,5-anhydro-D-mannitol |
| CAS: | 228862-97-3 |
| Molecular Formula: | C6H13 N O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H13NO4/c7-1-3-5(9)6(10)4(2-8)11-3/h3-6,8-10H,1-2,7H2/t3-,4-,5+,6?/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 188.851°C |
| Boiling Point: | 388.653°C at 760 mmHg |
| Density: | 1.394g/cm3 |
| Refractive index: | 1.557 |
| Flash Point: | 188.851°C |
| Usage: | 1-Amino-2,5-anhydro-1-deoxy-D-mannitol , a ?D-fructose analog, serves as a substrate for the hexose transporter of Trypanosoma brucei, while the human erythrocyte transporter can only use D-glucose. |
| Safety Data |
| |
 |
